C23H20ClF3N2O3 — CID 55795367
(E)-3-(6-chloro-2H-chromen-3-yl)-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 55795367) has the molecular formula C23H20ClF3N2O3 and a molecular weight of 464.87 g/mol. Its IUPAC name is (E)-3-(6-chloro-2H-chromen-3-yl)-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(6-chloro-2H-chromen-3-yl)-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55795367 |
| Molecular Formula | C23H20ClF3N2O3 |
| Molecular Weight | 464.87 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | (E)-3-(6-chloro-2H-chromen-3-yl)-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/C1=Cc2cc(Cl)ccc2OC1)Nc1ccc(N2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H20ClF3N2O3/c24-17-2-5-21-16(12-17)11-15(14-32-21)1-6-22(30)28-20-4-3-18(13-19(20)23(25,26)27)29-7-9-31-10-8-29/h1-6,11-13H,7-10,14H2,(H,28,30)/b6-1+ |
| InChIKey | GEYWQETYUNJNSO-LZCJLJQNSA-N |
| XLogP | 5.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.87 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|