C22H21F3N2O3 — CID 55794950
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 55794950) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55794950 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCO2)Nc1ccc(N2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H21F3N2O3/c23-22(24,25)18-14-17(27-8-11-29-12-9-27)3-4-19(18)26-21(28)6-2-15-1-5-20-16(13-15)7-10-30-20/h1-6,13-14H,7-12H2,(H,26,28)/b6-2+ |
| InChIKey | ZKNSFLCGYVTPHG-QHHAFSJGSA-N |
| XLogP | 4.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|