C23H22ClN3O3 — CID 24614186
3-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide (PubChem CID 24614186) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is 3-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 24614186 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 3-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide |
| SMILES | NC(=O)c1ccc(N2CCCC2)c(NC(=O)/C=C/C2=Cc3cc(Cl)ccc3OC2)c1 |
| InChI | InChI=1S/C23H22ClN3O3/c24-18-5-7-21-17(12-18)11-15(14-30-21)3-8-22(28)26-19-13-16(23(25)29)4-6-20(19)27-9-1-2-10-27/h3-8,11-13H,1-2,9-10,14H2,(H2,25,29)(H,26,28)/b8-3+ |
| InChIKey | FWGGHLDSCJRUKB-FPYGCLRLSA-N |
| XLogP | 4.01 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|