C22H25N3O3 — CID 41270258
3-[[(E)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide (PubChem CID 41270258) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[[(E)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-[[(E)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 41270258 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-[[(E)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide |
| SMILES | C[C@@H]1C[C@@H]1c1ccc(/C=C/C(=O)Nc2cc(C(N)=O)ccc2N2CCCC2)o1 |
| InChI | InChI=1S/C22H25N3O3/c1-14-12-17(14)20-8-5-16(28-20)6-9-21(26)24-18-13-15(22(23)27)4-7-19(18)25-10-2-3-11-25/h4-9,13-14,17H,2-3,10-12H2,1H3,(H2,23,27)(H,24,26)/b9-6+/t14-,17+/m1/s1 |
| InChIKey | UHUXUQMBTISQBJ-GIYGXLGSSA-N |
| XLogP | 3.75 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|