C21H29N3O2 — CID 30664855
3-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-4-pyrrolidin-1-ylbenzamide (PubChem CID 30664855) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 30664855 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 3-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-4-pyrrolidin-1-ylbenzamide |
| SMILES | CC(C)=C[C@@H]1[C@@H](C(=O)Nc2cc(C(N)=O)ccc2N2CCCC2)C1(C)C |
| InChI | InChI=1S/C21H29N3O2/c1-13(2)11-15-18(21(15,3)4)20(26)23-16-12-14(19(22)25)7-8-17(16)24-9-5-6-10-24/h7-8,11-12,15,18H,5-6,9-10H2,1-4H3,(H2,22,25)(H,23,26)/t15-,18+/m1/s1 |
| InChIKey | UXHFNHUFXPLGCV-QAPCUYQASA-N |
| XLogP | 3.56 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|