C17H23NO2 — CID 45352237
(E)-N-cyclohexyl-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide (PubChem CID 45352237) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (E)-N-cyclohexyl-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-cyclohexyl-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 45352237 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (E)-N-cyclohexyl-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
| SMILES | CC1CC1c1ccc(/C=C/C(=O)NC2CCCCC2)o1 |
| InChI | InChI=1S/C17H23NO2/c1-12-11-15(12)16-9-7-14(20-16)8-10-17(19)18-13-5-3-2-4-6-13/h7-10,12-13,15H,2-6,11H2,1H3,(H,18,19)/b10-8+ |
| InChIKey | XQKXBURFIIYKFA-CSKARUKUSA-N |
| XLogP | 3.87 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|