C11H11O3- — CID 7131871
(E)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enoate (PubChem CID 7131871) has the molecular formula C11H11O3- and a molecular weight of 191.21 g/mol. Its IUPAC name is (E)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enoate.
| Compound Name | (E)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7131871 |
| Molecular Formula | C11H11O3- |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (E)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enoate |
| SMILES | C[C@@H]1C[C@@H]1c1ccc(/C=C/C(=O)[O-])o1 |
| InChI | InChI=1S/C11H12O3/c1-7-6-9(7)10-4-2-8(14-10)3-5-11(12)13/h2-5,7,9H,6H2,1H3,(H,12,13)/p-1/b5-3+/t7-,9+/m1/s1 |
| InChIKey | AWPMLPOPHQPMJY-LVZKSCKVSA-M |
| XLogP | 1.17 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|