C15H20N2O3 — CID 98645041
N-methyl-3-[[(Z)-3-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]propanamide (PubChem CID 98645041) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-methyl-3-[[(Z)-3-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]propanamide.
| Compound Name | N-methyl-3-[[(Z)-3-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 98645041 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-methyl-3-[[(Z)-3-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]propanamide |
| SMILES | CNC(=O)CCNC(=O)/C=C\c1ccc([C@@H]2C[C@@H]2C)o1 |
| InChI | InChI=1S/C15H20N2O3/c1-10-9-12(10)13-5-3-11(20-13)4-6-15(19)17-8-7-14(18)16-2/h3-6,10,12H,7-9H2,1-2H3,(H,16,18)(H,17,19)/b6-4-/t10-,12+/m0/s1 |
| InChIKey | JGOLBQJUKGKUKL-PLLCSPFLSA-N |
| XLogP | 1.67 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|