C23H35N3O4 — CID 51952124
tert-butyl 4-[3-[[(E)-3-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 51952124) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl 4-[3-[[(E)-3-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[(E)-3-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 51952124 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | tert-butyl 4-[3-[[(E)-3-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H]1c1ccc(/C=C/C(=O)NCCCN2CCN(C(=O)OC(C)(C)C)CC2)o1 |
| InChI | InChI=1S/C23H35N3O4/c1-17-16-19(17)20-8-6-18(29-20)7-9-21(27)24-10-5-11-25-12-14-26(15-13-25)22(28)30-23(2,3)4/h6-9,17,19H,5,10-16H2,1-4H3,(H,24,27)/b9-7+/t17-,19-/m0/s1 |
| InChIKey | BRNMUYUTPMOACZ-VDWITTOHSA-N |
| XLogP | 3.48 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|