C35H60N6O8 — CID 68612774
tritert-butyl 10-[3-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 68612774) has the molecular formula C35H60N6O8 and a molecular weight of 692.90 g/mol. Its IUPAC name is tritert-butyl 10-[3-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | tritert-butyl 10-[3-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 68612774 |
| Molecular Formula | C35H60N6O8 |
| Molecular Weight | 692.90 g/mol |
| Exact Mass | 692.45 |
| IUPAC Name | tritert-butyl 10-[3-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCNC(=O)C(N)Cc2ccc(O)cc2)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C35H60N6O8/c1-33(2,3)47-30(44)39-19-17-38(16-10-15-37-29(43)28(36)25-26-11-13-27(42)14-12-26)18-20-40(31(45)48-34(4,5)6)22-24-41(23-21-39)32(46)49-35(7,8)9/h11-14,28,42H,10,15-25,36H2,1-9H3,(H,37,43) |
| InChIKey | ZDECCIYZEYFNGD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 167.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.90 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|