C11H13NO2 — CID 43237027
(E)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide (PubChem CID 43237027) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (E)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 43237027 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (E)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
| SMILES | CC1CC1c1ccc(/C=C/C(N)=O)o1 |
| InChI | InChI=1S/C11H13NO2/c1-7-6-9(7)10-4-2-8(14-10)3-5-11(12)13/h2-5,7,9H,6H2,1H3,(H2,12,13)/b5-3+ |
| InChIKey | MZPQEFGILAVWSC-HWKANZROSA-N |
| XLogP | 1.90 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|