C17H23NO3 — CID 104927612
(E)-N-[(1R,2R)-2-hydroxycyclohexyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide (PubChem CID 104927612) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is (E)-N-[(1R,2R)-2-hydroxycyclohexyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[(1R,2R)-2-hydroxycyclohexyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 104927612 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (E)-N-[(1R,2R)-2-hydroxycyclohexyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
| SMILES | CC1CC1c1ccc(/C=C/C(=O)N[C@@H]2CCCC[C@H]2O)o1 |
| InChI | InChI=1S/C17H23NO3/c1-11-10-13(11)16-8-6-12(21-16)7-9-17(20)18-14-4-2-3-5-15(14)19/h6-9,11,13-15,19H,2-5,10H2,1H3,(H,18,20)/b9-7+/t11?,13?,14-,15-/m1/s1 |
| InChIKey | LRLWTDAKIDCVKU-XGJACEKTSA-N |
| XLogP | 2.84 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|