C22H27N3O3 — CID 167756186
N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-5-cyclohexylfuran-2-carboxamide (PubChem CID 167756186) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-5-cyclohexylfuran-2-carboxamide.
| Compound Name | N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-5-cyclohexylfuran-2-carboxamide |
|---|---|
| PubChem CID | 167756186 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-5-cyclohexylfuran-2-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCCC2)c(NC(=O)c2ccc(C3CCCCC3)o2)c1 |
| InChI | InChI=1S/C22H27N3O3/c23-21(26)16-8-9-18(25-12-4-5-13-25)17(14-16)24-22(27)20-11-10-19(28-20)15-6-2-1-3-7-15/h8-11,14-15H,1-7,12-13H2,(H2,23,26)(H,24,27) |
| InChIKey | UMBSOBPACMMPQY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |