C25H32N2O4 — CID 138505426
N-[5-cyclopropyl-2-[(4R)-4-hydroxyazepan-1-yl]phenyl]-5-(oxan-4-yl)furan-2-carboxamide (PubChem CID 138505426) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-[5-cyclopropyl-2-[(4R)-4-hydroxyazepan-1-yl]phenyl]-5-(oxan-4-yl)furan-2-carboxamide.
| Compound Name | N-[5-cyclopropyl-2-[(4R)-4-hydroxyazepan-1-yl]phenyl]-5-(oxan-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 138505426 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N-[5-cyclopropyl-2-[(4R)-4-hydroxyazepan-1-yl]phenyl]-5-(oxan-4-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1cc(C2CC2)ccc1N1CCC[C@@H](O)CC1)c1ccc(C2CCOCC2)o1 |
| InChI | InChI=1S/C25H32N2O4/c28-20-2-1-12-27(13-9-20)22-6-5-19(17-3-4-17)16-21(22)26-25(29)24-8-7-23(31-24)18-10-14-30-15-11-18/h5-8,16-18,20,28H,1-4,9-15H2,(H,26,29)/t20-/m1/s1 |
| InChIKey | CLLKJTNBTLXBDI-HXUWFJFHSA-N |
| XLogP | 4.65 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |