C24H20ClF3N2O4 — CID 55782149
N-[4-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide (PubChem CID 55782149) has the molecular formula C24H20ClF3N2O4 and a molecular weight of 492.88 g/mol. Its IUPAC name is N-[4-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide.
| Compound Name | N-[4-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 55782149 |
| Molecular Formula | C24H20ClF3N2O4 |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | N-[4-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(/C=C/C1=Cc2cc(Cl)ccc2OC1)Nc1ccc(NC(=O)C2CCCO2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H20ClF3N2O4/c25-16-4-7-20-15(11-16)10-14(13-34-20)3-8-22(31)30-19-6-5-17(12-18(19)24(26,27)28)29-23(32)21-2-1-9-33-21/h3-8,10-12,21H,1-2,9,13H2,(H,29,32)(H,30,31)/b8-3+ |
| InChIKey | MLTFHJKXMCPUHQ-FPYGCLRLSA-N |
| XLogP | 5.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|