C29H26ClN3O5S2 — CID 175442318
5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-(naphthalen-2-ylsulfonylamino)ethyl]-1H-indole-2-carboxamide (PubChem CID 175442318) has the molecular formula C29H26ClN3O5S2 and a molecular weight of 596.13 g/mol. Its IUPAC name is 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-(naphthalen-2-ylsulfonylamino)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-(naphthalen-2-ylsulfonylamino)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 175442318 |
| Molecular Formula | C29H26ClN3O5S2 |
| Molecular Weight | 596.13 g/mol |
| Exact Mass | 595.10 |
| IUPAC Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-(naphthalen-2-ylsulfonylamino)ethyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)c2c(C(=O)NCCNS(=O)(=O)c3ccc4ccccc4c3)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C29H26ClN3O5S2/c1-18-13-19(2)15-24(14-18)39(35,36)28-25-17-22(30)8-10-26(25)33-27(28)29(34)31-11-12-32-40(37,38)23-9-7-20-5-3-4-6-21(20)16-23/h3-10,13-17,32-33H,11-12H2,1-2H3,(H,31,34) |
| InChIKey | JWPSABDYDXKNRI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.13 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|