C27H27ClFN3O5S2 — CID 166068026
5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[4-[(4-fluorophenyl)sulfonylamino]butyl]-1H-indole-2-carboxamide (PubChem CID 166068026) has the molecular formula C27H27ClFN3O5S2 and a molecular weight of 592.11 g/mol. Its IUPAC name is 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[4-[(4-fluorophenyl)sulfonylamino]butyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[4-[(4-fluorophenyl)sulfonylamino]butyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166068026 |
| Molecular Formula | C27H27ClFN3O5S2 |
| Molecular Weight | 592.11 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[4-[(4-fluorophenyl)sulfonylamino]butyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)c2c(C(=O)NCCCCNS(=O)(=O)c3ccc(F)cc3)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C27H27ClFN3O5S2/c1-17-13-18(2)15-22(14-17)38(34,35)26-23-16-19(28)5-10-24(23)32-25(26)27(33)30-11-3-4-12-31-39(36,37)21-8-6-20(29)7-9-21/h5-10,13-16,31-32H,3-4,11-12H2,1-2H3,(H,30,33) |
| InChIKey | GEUABKGVZUUHMB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.11 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|