C23H22ClN5O5S — CID 510650
5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-(5-methyl-2-nitroimidazol-1-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 510650) has the molecular formula C23H22ClN5O5S and a molecular weight of 515.98 g/mol. Its IUPAC name is 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-(5-methyl-2-nitroimidazol-1-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-(5-methyl-2-nitroimidazol-1-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 510650 |
| Molecular Formula | C23H22ClN5O5S |
| Molecular Weight | 515.98 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-(5-methyl-2-nitroimidazol-1-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)c2c(C(=O)NCCn3c(C)cnc3[N+](=O)[O-])[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C23H22ClN5O5S/c1-13-8-14(2)10-17(9-13)35(33,34)21-18-11-16(24)4-5-19(18)27-20(21)22(30)25-6-7-28-15(3)12-26-23(28)29(31)32/h4-5,8-12,27H,6-7H2,1-3H3,(H,25,30) |
| InChIKey | DIQIBEOCIMQSAT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 139.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.98 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|