C19H19ClN2O5S2 — CID 155519742
5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-ethylsulfonyl-1H-indole-2-carboxamide (PubChem CID 155519742) has the molecular formula C19H19ClN2O5S2 and a molecular weight of 454.96 g/mol. Its IUPAC name is 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-ethylsulfonyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-ethylsulfonyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 155519742 |
| Molecular Formula | C19H19ClN2O5S2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-ethylsulfonyl-1H-indole-2-carboxamide |
| SMILES | CCS(=O)(=O)NC(=O)c1[nH]c2ccc(Cl)cc2c1S(=O)(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H19ClN2O5S2/c1-4-28(24,25)22-19(23)17-18(15-10-13(20)5-6-16(15)21-17)29(26,27)14-8-11(2)7-12(3)9-14/h5-10,21H,4H2,1-3H3,(H,22,23) |
| InChIKey | DWEKULPOBKOCHV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |