C16H14ClNO3S — CID 70947557
5-chloro-3-(3,5-dimethylphenyl)sulfonyl-1H-indol-2-ol (PubChem CID 70947557) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-1H-indol-2-ol.
| Compound Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-1H-indol-2-ol |
|---|---|
| PubChem CID | 70947557 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-1H-indol-2-ol |
| SMILES | Cc1cc(C)cc(S(=O)(=O)c2c(O)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C16H14ClNO3S/c1-9-5-10(2)7-12(6-9)22(20,21)15-13-8-11(17)3-4-14(13)18-16(15)19/h3-8,18-19H,1-2H3 |
| InChIKey | HLNRKCCAPMRIPS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |