C25H25ClN6O6S — CID 134815290
5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-[2-(5-methyl-2-nitroimidazol-1-yl)ethylamino]-2-oxoethyl]-1H-indole-2-carboxamide (PubChem CID 134815290) has the molecular formula C25H25ClN6O6S and a molecular weight of 573.03 g/mol. Its IUPAC name is 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-[2-(5-methyl-2-nitroimidazol-1-yl)ethylamino]-2-oxoethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-[2-(5-methyl-2-nitroimidazol-1-yl)ethylamino]-2-oxoethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 134815290 |
| Molecular Formula | C25H25ClN6O6S |
| Molecular Weight | 573.03 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N-[2-[2-(5-methyl-2-nitroimidazol-1-yl)ethylamino]-2-oxoethyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)c2c(C(=O)NCC(=O)NCCn3c(C)cnc3[N+](=O)[O-])[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C25H25ClN6O6S/c1-14-8-15(2)10-18(9-14)39(37,38)23-19-11-17(26)4-5-20(19)30-22(23)24(34)28-13-21(33)27-6-7-31-16(3)12-29-25(31)32(35)36/h4-5,8-12,30H,6-7,13H2,1-3H3,(H,27,33)(H,28,34) |
| InChIKey | BLEMISTXAJHZDO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 169.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.03 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|