C16H17ClN2O2S2 — CID 113086266
5-chloro-N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 113086266) has the molecular formula C16H17ClN2O2S2 and a molecular weight of 368.91 g/mol. Its IUPAC name is 5-chloro-N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113086266 |
| Molecular Formula | C16H17ClN2O2S2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 5-chloro-N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc2[nH]c(C)c(CCNS(=O)(=O)c3ccc(Cl)s3)c2c1 |
| InChI | InChI=1S/C16H17ClN2O2S2/c1-10-3-4-14-13(9-10)12(11(2)19-14)7-8-18-23(20,21)16-6-5-15(17)22-16/h3-6,9,18-19H,7-8H2,1-2H3 |
| InChIKey | HFXXXCVEOSYYAZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|