C12H10Cl3NO2S2 — CID 113098447
5-chloro-N-[2-(2,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 113098447) has the molecular formula C12H10Cl3NO2S2 and a molecular weight of 370.71 g/mol. Its IUPAC name is 5-chloro-N-[2-(2,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(2,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113098447 |
| Molecular Formula | C12H10Cl3NO2S2 |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | 5-chloro-N-[2-(2,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(Cl)cc1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H10Cl3NO2S2/c13-9-2-1-8(10(14)7-9)5-6-16-20(17,18)12-4-3-11(15)19-12/h1-4,7,16H,5-6H2 |
| InChIKey | MUUAICSSVBEPQG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |