C15H13ClN2O3S2 — CID 110314704
5-chloro-N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110314704) has the molecular formula C15H13ClN2O3S2 and a molecular weight of 368.87 g/mol. Its IUPAC name is 5-chloro-N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110314704 |
| Molecular Formula | C15H13ClN2O3S2 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 5-chloro-N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCc1cc(-c2ccccc2)on1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H13ClN2O3S2/c16-14-6-7-15(22-14)23(19,20)17-9-8-12-10-13(21-18-12)11-4-2-1-3-5-11/h1-7,10,17H,8-9H2 |
| InChIKey | SQAVDTGUNCGRQK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |