C16H13Cl2N3O3S — CID 110312503
6-chloro-N-[2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]ethyl]pyridine-3-sulfonamide (PubChem CID 110312503) has the molecular formula C16H13Cl2N3O3S and a molecular weight of 398.27 g/mol. Its IUPAC name is 6-chloro-N-[2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]ethyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 110312503 |
| Molecular Formula | C16H13Cl2N3O3S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 6-chloro-N-[2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]ethyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCc1cc(-c2ccc(Cl)cc2)on1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H13Cl2N3O3S/c17-12-3-1-11(2-4-12)15-9-13(21-24-15)7-8-20-25(22,23)14-5-6-16(18)19-10-14/h1-6,9-10,20H,7-8H2 |
| InChIKey | HKYOSCVCBBDSEE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|