C13H16N2O3S — CID 110314681
N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]ethanesulfonamide (PubChem CID 110314681) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110314681 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C13H16N2O3S/c1-2-19(16,17)14-9-8-12-10-13(18-15-12)11-6-4-3-5-7-11/h3-7,10,14H,2,8-9H2,1H3 |
| InChIKey | JMYXTEDMQSYGSE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |