C17H15ClN2O2S2 — CID 2386160
4-chloro-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 2386160) has the molecular formula C17H15ClN2O2S2 and a molecular weight of 378.91 g/mol. Its IUPAC name is 4-chloro-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2386160 |
| Molecular Formula | C17H15ClN2O2S2 |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 4-chloro-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1csc(-c2ccccc2)n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O2S2/c18-14-6-8-16(9-7-14)24(21,22)19-11-10-15-12-23-17(20-15)13-4-2-1-3-5-13/h1-9,12,19H,10-11H2 |
| InChIKey | KEVWMXJFKDCDMR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |