C17H14F2N2O2S2 — CID 110317259
N-[2-[2-(2,6-difluorophenyl)-1,3-thiazol-4-yl]ethyl]benzenesulfonamide (PubChem CID 110317259) has the molecular formula C17H14F2N2O2S2 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[2-[2-(2,6-difluorophenyl)-1,3-thiazol-4-yl]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[2-(2,6-difluorophenyl)-1,3-thiazol-4-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110317259 |
| Molecular Formula | C17H14F2N2O2S2 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-[2-[2-(2,6-difluorophenyl)-1,3-thiazol-4-yl]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1csc(-c2c(F)cccc2F)n1)c1ccccc1 |
| InChI | InChI=1S/C17H14F2N2O2S2/c18-14-7-4-8-15(19)16(14)17-21-12(11-24-17)9-10-20-25(22,23)13-5-2-1-3-6-13/h1-8,11,20H,9-10H2 |
| InChIKey | VLEJMDCBKGQHPG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |