C11H8BrF2NS — CID 83971235
4-(2-bromoethyl)-2-(2,6-difluorophenyl)-1,3-thiazole (PubChem CID 83971235) has the molecular formula C11H8BrF2NS and a molecular weight of 304.16 g/mol. Its IUPAC name is 4-(2-bromoethyl)-2-(2,6-difluorophenyl)-1,3-thiazole.
| Compound Name | 4-(2-bromoethyl)-2-(2,6-difluorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 83971235 |
| Molecular Formula | C11H8BrF2NS |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 302.95 |
| IUPAC Name | 4-(2-bromoethyl)-2-(2,6-difluorophenyl)-1,3-thiazole |
| SMILES | Fc1cccc(F)c1-c1nc(CCBr)cs1 |
| InChI | InChI=1S/C11H8BrF2NS/c12-5-4-7-6-16-11(15-7)10-8(13)2-1-3-9(10)14/h1-3,6H,4-5H2 |
| InChIKey | WABLLUMJJQTRNQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|