C15H17F2N3S — CID 93213722
2-(2,6-difluorophenyl)-4-(2-piperazin-1-ylethyl)-1,3-thiazole (PubChem CID 93213722) has the molecular formula C15H17F2N3S and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-(2-piperazin-1-ylethyl)-1,3-thiazole.
| Compound Name | 2-(2,6-difluorophenyl)-4-(2-piperazin-1-ylethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 93213722 |
| Molecular Formula | C15H17F2N3S |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-(2-piperazin-1-ylethyl)-1,3-thiazole |
| SMILES | Fc1cccc(F)c1-c1nc(CCN2CCNCC2)cs1 |
| InChI | InChI=1S/C15H17F2N3S/c16-12-2-1-3-13(17)14(12)15-19-11(10-21-15)4-7-20-8-5-18-6-9-20/h1-3,10,18H,4-9H2 |
| InChIKey | LQEISJPCVQBKLB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |