C9H16N4S — CID 82508561
4-(2-piperazin-1-ylethyl)-1,3-thiazol-2-amine (PubChem CID 82508561) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 4-(2-piperazin-1-ylethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-piperazin-1-ylethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82508561 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 4-(2-piperazin-1-ylethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(CCN2CCNCC2)cs1 |
| InChI | InChI=1S/C9H16N4S/c10-9-12-8(7-14-9)1-4-13-5-2-11-3-6-13/h7,11H,1-6H2,(H2,10,12) |
| InChIKey | OTXLGGHELDVPEF-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |