C16H22N4S — CID 141070766
4-[2-(3-piperazin-1-ylpropyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 141070766) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 4-[2-(3-piperazin-1-ylpropyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(3-piperazin-1-ylpropyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 141070766 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-[2-(3-piperazin-1-ylpropyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccccc2CCCN2CCNCC2)cs1 |
| InChI | InChI=1S/C16H22N4S/c17-16-19-15(12-21-16)14-6-2-1-4-13(14)5-3-9-20-10-7-18-8-11-20/h1-2,4,6,12,18H,3,5,7-11H2,(H2,17,19) |
| InChIKey | PKHSXGJUQDZNCS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |