C15H21N3O — CID 117402585
2-[2-(2-piperazin-1-ylethyl)phenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 117402585) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-[2-(2-piperazin-1-ylethyl)phenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-[2-(2-piperazin-1-ylethyl)phenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 117402585 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-[2-(2-piperazin-1-ylethyl)phenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(C2=NCCO2)c(CCN2CCNCC2)c1 |
| InChI | InChI=1S/C15H21N3O/c1-2-4-14(15-17-8-12-19-15)13(3-1)5-9-18-10-6-16-7-11-18/h1-4,16H,5-12H2 |
| InChIKey | VCTCRDKHRZLHFF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |