C11H12N2S — CID 112562140
4-(2-ethylphenyl)-1,3-thiazol-2-amine (PubChem CID 112562140) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 4-(2-ethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-ethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 112562140 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 4-(2-ethylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCc1ccccc1-c1csc(N)n1 |
| InChI | InChI=1S/C11H12N2S/c1-2-8-5-3-4-6-9(8)10-7-14-11(12)13-10/h3-7H,2H2,1H3,(H2,12,13) |
| InChIKey | VEPMDWQYBYHBHI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |