C10H10N2OS — CID 105459084
[2-(2-amino-1,3-thiazol-4-yl)phenyl]methanol (PubChem CID 105459084) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is [2-(2-amino-1,3-thiazol-4-yl)phenyl]methanol.
| Compound Name | [2-(2-amino-1,3-thiazol-4-yl)phenyl]methanol |
|---|---|
| PubChem CID | 105459084 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | [2-(2-amino-1,3-thiazol-4-yl)phenyl]methanol |
| SMILES | Nc1nc(-c2ccccc2CO)cs1 |
| InChI | InChI=1S/C10H10N2OS/c11-10-12-9(6-14-10)8-4-2-1-3-7(8)5-13/h1-4,6,13H,5H2,(H2,11,12) |
| InChIKey | HJOXCKSHEXKQCH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |