C11H12N2O2S — CID 28857958
2-[2-(2-amino-1,3-thiazol-4-yl)phenoxy]ethanol (PubChem CID 28857958) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-[2-(2-amino-1,3-thiazol-4-yl)phenoxy]ethanol.
| Compound Name | 2-[2-(2-amino-1,3-thiazol-4-yl)phenoxy]ethanol |
|---|---|
| PubChem CID | 28857958 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-[2-(2-amino-1,3-thiazol-4-yl)phenoxy]ethanol |
| SMILES | Nc1nc(-c2ccccc2OCCO)cs1 |
| InChI | InChI=1S/C11H12N2O2S/c12-11-13-9(7-16-11)8-3-1-2-4-10(8)15-6-5-14/h1-4,7,14H,5-6H2,(H2,12,13) |
| InChIKey | FBPGCYSQULKDSI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |