C15H16F3NO2S — CID 160850769
5-[2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]phenoxy]pentan-1-ol (PubChem CID 160850769) has the molecular formula C15H16F3NO2S and a molecular weight of 331.36 g/mol. Its IUPAC name is 5-[2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]phenoxy]pentan-1-ol.
| Compound Name | 5-[2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]phenoxy]pentan-1-ol |
|---|---|
| PubChem CID | 160850769 |
| Molecular Formula | C15H16F3NO2S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 5-[2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]phenoxy]pentan-1-ol |
| SMILES | OCCCCCOc1ccccc1-c1csc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H16F3NO2S/c16-15(17,18)14-19-12(10-22-14)11-6-2-3-7-13(11)21-9-5-1-4-8-20/h2-3,6-7,10,20H,1,4-5,8-9H2 |
| InChIKey | WNHQTHXOIDBCQR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|