C15H20N2OS — CID 61338431
2-[4-(2-ethoxyphenyl)-1,3-thiazol-2-yl]butan-2-amine (PubChem CID 61338431) has the molecular formula C15H20N2OS and a molecular weight of 276.41 g/mol. Its IUPAC name is 2-[4-(2-ethoxyphenyl)-1,3-thiazol-2-yl]butan-2-amine.
| Compound Name | 2-[4-(2-ethoxyphenyl)-1,3-thiazol-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 61338431 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-[4-(2-ethoxyphenyl)-1,3-thiazol-2-yl]butan-2-amine |
| SMILES | CCOc1ccccc1-c1csc(C(C)(N)CC)n1 |
| InChI | InChI=1S/C15H20N2OS/c1-4-15(3,16)14-17-12(10-19-14)11-8-6-7-9-13(11)18-5-2/h6-10H,4-5,16H2,1-3H3 |
| InChIKey | WLNUUVHSUHPDTK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |