C17H16N2OS — CID 43667895
3-[4-(2-ethoxyphenyl)-1,3-thiazol-2-yl]aniline (PubChem CID 43667895) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is 3-[4-(2-ethoxyphenyl)-1,3-thiazol-2-yl]aniline.
| Compound Name | 3-[4-(2-ethoxyphenyl)-1,3-thiazol-2-yl]aniline |
|---|---|
| PubChem CID | 43667895 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-[4-(2-ethoxyphenyl)-1,3-thiazol-2-yl]aniline |
| SMILES | CCOc1ccccc1-c1csc(-c2cccc(N)c2)n1 |
| InChI | InChI=1S/C17H16N2OS/c1-2-20-16-9-4-3-8-14(16)15-11-21-17(19-15)12-6-5-7-13(18)10-12/h3-11H,2,18H2,1H3 |
| InChIKey | DJLLORWRSMUZAH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|