C14H11N3S — CID 7148715
3-(4-pyridin-2-yl-1,3-thiazol-2-yl)aniline (PubChem CID 7148715) has the molecular formula C14H11N3S and a molecular weight of 253.33 g/mol. Its IUPAC name is 3-(4-pyridin-2-yl-1,3-thiazol-2-yl)aniline.
| Compound Name | 3-(4-pyridin-2-yl-1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 7148715 |
| Molecular Formula | C14H11N3S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3-(4-pyridin-2-yl-1,3-thiazol-2-yl)aniline |
| SMILES | Nc1cccc(-c2nc(-c3ccccn3)cs2)c1 |
| InChI | InChI=1S/C14H11N3S/c15-11-5-3-4-10(8-11)14-17-13(9-18-14)12-6-1-2-7-16-12/h1-9H,15H2 |
| InChIKey | RTVUNJNXDGTPBZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|