C10H8N2OS — CID 45480208
2-(3-aminophenyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 45480208) has the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-(3-aminophenyl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-(3-aminophenyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 45480208 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2-(3-aminophenyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | Nc1cccc(-c2nc(C=O)cs2)c1 |
| InChI | InChI=1S/C10H8N2OS/c11-8-3-1-2-7(4-8)10-12-9(5-13)6-14-10/h1-6H,11H2 |
| InChIKey | WUNYYDGWNXLCCC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|