C11H10N2OS — CID 91664700
2-(2-ethyl-4-pyridinyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 91664700) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 2-(2-ethyl-4-pyridinyl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-(2-ethyl-4-pyridinyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 91664700 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-(2-ethyl-4-pyridinyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | CCc1cc(-c2nc(C=O)cs2)ccn1 |
| InChI | InChI=1S/C11H10N2OS/c1-2-9-5-8(3-4-12-9)11-13-10(6-14)7-15-11/h3-7H,2H2,1H3 |
| InChIKey | QUDKZEFZXYCSBI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|