C16H15N3S — CID 107504187
3-[2-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-4-yl]aniline (PubChem CID 107504187) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-[2-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-4-yl]aniline.
| Compound Name | 3-[2-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 107504187 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-[2-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-4-yl]aniline |
| SMILES | Cc1cc(-c2nc(-c3cccc(N)c3)cs2)cc(C)n1 |
| InChI | InChI=1S/C16H15N3S/c1-10-6-13(7-11(2)18-10)16-19-15(9-20-16)12-4-3-5-14(17)8-12/h3-9H,17H2,1-2H3 |
| InChIKey | OFUPIDHVBTVWJP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|