C14H12N4OS — CID 103374862
3-[2-(6-methoxypyridazin-3-yl)-1,3-thiazol-4-yl]aniline (PubChem CID 103374862) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-[2-(6-methoxypyridazin-3-yl)-1,3-thiazol-4-yl]aniline.
| Compound Name | 3-[2-(6-methoxypyridazin-3-yl)-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 103374862 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 3-[2-(6-methoxypyridazin-3-yl)-1,3-thiazol-4-yl]aniline |
| SMILES | COc1ccc(-c2nc(-c3cccc(N)c3)cs2)nn1 |
| InChI | InChI=1S/C14H12N4OS/c1-19-13-6-5-11(17-18-13)14-16-12(8-20-14)9-3-2-4-10(15)7-9/h2-8H,15H2,1H3 |
| InChIKey | KTEVYRBEMMVGII-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|