C21H21N5O3S2 — CID 21357966
5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine (PubChem CID 21357966) has the molecular formula C21H21N5O3S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is 5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine.
| Compound Name | 5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 21357966 |
| Molecular Formula | C21H21N5O3S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cccc(N)c4)cs3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C21H21N5O3S2/c1-27-15-8-13(9-16(28-2)17(15)29-3)24-21-26-19(23)18(31-21)20-25-14(10-30-20)11-5-4-6-12(22)7-11/h4-10H,22-23H2,1-3H3,(H,24,26) |
| InChIKey | DZTJUPMWMPDPIY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|