C26H24N6O6S3 — CID 91374414
N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 91374414) has the molecular formula C26H24N6O6S3 and a molecular weight of 612.72 g/mol. Its IUPAC name is N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 91374414 |
| Molecular Formula | C26H24N6O6S3 |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.09 |
| IUPAC Name | N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cccc(NC(=O)Cn5c(O)csc5=O)c4)cs3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C26H24N6O6S3/c1-36-17-8-15(9-18(37-2)21(17)38-3)29-25-31-23(27)22(41-25)24-30-16(11-39-24)13-5-4-6-14(7-13)28-19(33)10-32-20(34)12-40-26(32)35/h4-9,11-12,34H,10,27H2,1-3H3,(H,28,33)(H,29,31) |
| InChIKey | UVCRTPARRUWRTC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 162.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |