C30H28ClN5O4S2 — CID 21358232
N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-4-(2-chloroethyl)benzamide (PubChem CID 21358232) has the molecular formula C30H28ClN5O4S2 and a molecular weight of 622.17 g/mol. Its IUPAC name is N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-4-(2-chloroethyl)benzamide.
| Compound Name | N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-4-(2-chloroethyl)benzamide |
|---|---|
| PubChem CID | 21358232 |
| Molecular Formula | C30H28ClN5O4S2 |
| Molecular Weight | 622.17 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-4-(2-chloroethyl)benzamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cccc(NC(=O)c5ccc(CCCl)cc5)c4)cs3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C30H28ClN5O4S2/c1-38-23-14-21(15-24(39-2)25(23)40-3)34-30-36-27(32)26(42-30)29-35-22(16-41-29)19-5-4-6-20(13-19)33-28(37)18-9-7-17(8-10-18)11-12-31/h4-10,13-16H,11-12,32H2,1-3H3,(H,33,37)(H,34,36) |
| InChIKey | JVNZFQKRIMUSHR-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.17 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|