C31H26N6O6S2 — CID 21358176
N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 21358176) has the molecular formula C31H26N6O6S2 and a molecular weight of 642.72 g/mol. Its IUPAC name is N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 21358176 |
| Molecular Formula | C31H26N6O6S2 |
| Molecular Weight | 642.72 g/mol |
| Exact Mass | 642.14 |
| IUPAC Name | N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cccc(NC(=O)c5ccc6c(c5)C(=O)N(C)C6=O)c4)cs3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C31H26N6O6S2/c1-37-29(39)19-9-8-16(11-20(19)30(37)40)27(38)33-17-7-5-6-15(10-17)21-14-44-28(35-21)25-26(32)36-31(45-25)34-18-12-22(41-2)24(43-4)23(13-18)42-3/h5-14H,32H2,1-4H3,(H,33,38)(H,34,36) |
| InChIKey | YYGIDUVFZSZXLC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 158.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.72 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|