C35H31N5O6S2 — CID 142653534
N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2,2-diphenoxyacetamide (PubChem CID 142653534) has the molecular formula C35H31N5O6S2 and a molecular weight of 681.80 g/mol. Its IUPAC name is N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2,2-diphenoxyacetamide.
| Compound Name | N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2,2-diphenoxyacetamide |
|---|---|
| PubChem CID | 142653534 |
| Molecular Formula | C35H31N5O6S2 |
| Molecular Weight | 681.80 g/mol |
| Exact Mass | 681.17 |
| IUPAC Name | N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-2,2-diphenoxyacetamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cccc(NC(=O)C(Oc5ccccc5)Oc5ccccc5)c4)cs3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C35H31N5O6S2/c1-42-27-18-23(19-28(43-2)29(27)44-3)38-35-40-31(36)30(48-35)33-39-26(20-47-33)21-11-10-12-22(17-21)37-32(41)34(45-24-13-6-4-7-14-24)46-25-15-8-5-9-16-25/h4-20,34H,36H2,1-3H3,(H,37,41)(H,38,40) |
| InChIKey | MLQRKIDLRPMJCU-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.80 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|