C30H27N5O4S2 — CID 21358228
(E)-N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-3-phenylprop-2-enamide (PubChem CID 21358228) has the molecular formula C30H27N5O4S2 and a molecular weight of 585.71 g/mol. Its IUPAC name is (E)-N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 21358228 |
| Molecular Formula | C30H27N5O4S2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | (E)-N-[3-[2-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-3-phenylprop-2-enamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cccc(NC(=O)/C=C/c5ccccc5)c4)cs3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C30H27N5O4S2/c1-37-23-15-21(16-24(38-2)26(23)39-3)33-30-35-28(31)27(41-30)29-34-22(17-40-29)19-10-7-11-20(14-19)32-25(36)13-12-18-8-5-4-6-9-18/h4-17H,31H2,1-3H3,(H,32,36)(H,33,35)/b13-12+ |
| InChIKey | XUWKGVQLHCUVHA-OUKQBFOZSA-N |
| XLogP | 6.94 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|